C32H36N2O2S — CID 22079874
6-[5-methoxy-3-methyl-2-(4-phenylsulfanylphenyl)indol-1-yl]-1-pyrrolidin-1-ylhexan-1-one (PubChem CID 22079874) has the molecular formula C32H36N2O2S and a molecular weight of 512.72 g/mol. Its IUPAC name is 6-[5-methoxy-3-methyl-2-(4-phenylsulfanylphenyl)indol-1-yl]-1-pyrrolidin-1-ylhexan-1-one.
| Compound Name | 6-[5-methoxy-3-methyl-2-(4-phenylsulfanylphenyl)indol-1-yl]-1-pyrrolidin-1-ylhexan-1-one |
|---|---|
| PubChem CID | 22079874 |
| Molecular Formula | C32H36N2O2S |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 6-[5-methoxy-3-methyl-2-(4-phenylsulfanylphenyl)indol-1-yl]-1-pyrrolidin-1-ylhexan-1-one |
| SMILES | COc1ccc2c(c1)c(C)c(-c1ccc(Sc3ccccc3)cc1)n2CCCCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C32H36N2O2S/c1-24-29-23-26(36-2)16-19-30(29)34(22-8-4-7-13-31(35)33-20-9-10-21-33)32(24)25-14-17-28(18-15-25)37-27-11-5-3-6-12-27/h3,5-6,11-12,14-19,23H,4,7-10,13,20-22H2,1-2H3 |
| InChIKey | CCWZNOKVNOZNOO-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|