C30H34N2O2S — CID 18984801
6-[5-methoxy-3-methyl-2-(4-phenylthiophen-2-yl)indol-1-yl]-1-pyrrolidin-1-ylhexan-1-one (PubChem CID 18984801) has the molecular formula C30H34N2O2S and a molecular weight of 486.68 g/mol. Its IUPAC name is 6-[5-methoxy-3-methyl-2-(4-phenylthiophen-2-yl)indol-1-yl]-1-pyrrolidin-1-ylhexan-1-one.
| Compound Name | 6-[5-methoxy-3-methyl-2-(4-phenylthiophen-2-yl)indol-1-yl]-1-pyrrolidin-1-ylhexan-1-one |
|---|---|
| PubChem CID | 18984801 |
| Molecular Formula | C30H34N2O2S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 6-[5-methoxy-3-methyl-2-(4-phenylthiophen-2-yl)indol-1-yl]-1-pyrrolidin-1-ylhexan-1-one |
| SMILES | COc1ccc2c(c1)c(C)c(-c1cc(-c3ccccc3)cs1)n2CCCCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C30H34N2O2S/c1-22-26-20-25(34-2)14-15-27(26)32(18-8-4-7-13-29(33)31-16-9-10-17-31)30(22)28-19-24(21-35-28)23-11-5-3-6-12-23/h3,5-6,11-12,14-15,19-21H,4,7-10,13,16-18H2,1-2H3 |
| InChIKey | FOMMWEVBVSUBLP-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|