C30H29NO3S — CID 57255556
4-[4-(6-methoxy-2-phenyl-1-benzothiophene-3-carbonyl)phenyl]-1-pyrrolidin-1-ylbutan-1-one (PubChem CID 57255556) has the molecular formula C30H29NO3S and a molecular weight of 483.63 g/mol. Its IUPAC name is 4-[4-(6-methoxy-2-phenyl-1-benzothiophene-3-carbonyl)phenyl]-1-pyrrolidin-1-ylbutan-1-one.
| Compound Name | 4-[4-(6-methoxy-2-phenyl-1-benzothiophene-3-carbonyl)phenyl]-1-pyrrolidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 57255556 |
| Molecular Formula | C30H29NO3S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 4-[4-(6-methoxy-2-phenyl-1-benzothiophene-3-carbonyl)phenyl]-1-pyrrolidin-1-ylbutan-1-one |
| SMILES | COc1ccc2c(C(=O)c3ccc(CCCC(=O)N4CCCC4)cc3)c(-c3ccccc3)sc2c1 |
| InChI | InChI=1S/C30H29NO3S/c1-34-24-16-17-25-26(20-24)35-30(23-9-3-2-4-10-23)28(25)29(33)22-14-12-21(13-15-22)8-7-11-27(32)31-18-5-6-19-31/h2-4,9-10,12-17,20H,5-8,11,18-19H2,1H3 |
| InChIKey | GODAJBDSVLKUQV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |