C27H36N2O2 — CID 15925649
2-(4-hydroxyphenyl)-3-methyl-1-(8-pyrrolidin-1-yloctyl)indol-5-ol (PubChem CID 15925649) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-3-methyl-1-(8-pyrrolidin-1-yloctyl)indol-5-ol.
| Compound Name | 2-(4-hydroxyphenyl)-3-methyl-1-(8-pyrrolidin-1-yloctyl)indol-5-ol |
|---|---|
| PubChem CID | 15925649 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 2-(4-hydroxyphenyl)-3-methyl-1-(8-pyrrolidin-1-yloctyl)indol-5-ol |
| SMILES | Cc1c(-c2ccc(O)cc2)n(CCCCCCCCN2CCCC2)c2ccc(O)cc12 |
| InChI | InChI=1S/C27H36N2O2/c1-21-25-20-24(31)14-15-26(25)29(27(21)22-10-12-23(30)13-11-22)19-7-5-3-2-4-6-16-28-17-8-9-18-28/h10-15,20,30-31H,2-9,16-19H2,1H3 |
| InChIKey | GQAQMMUNPNSZIA-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|