C25H29N3O4 — CID 141451332
1-ethyl-4-[4-[5-hydroxy-2-(4-hydroxyphenyl)-3-methylindol-1-yl]butyl]piperazine-2,3-dione (PubChem CID 141451332) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-ethyl-4-[4-[5-hydroxy-2-(4-hydroxyphenyl)-3-methylindol-1-yl]butyl]piperazine-2,3-dione.
| Compound Name | 1-ethyl-4-[4-[5-hydroxy-2-(4-hydroxyphenyl)-3-methylindol-1-yl]butyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 141451332 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 1-ethyl-4-[4-[5-hydroxy-2-(4-hydroxyphenyl)-3-methylindol-1-yl]butyl]piperazine-2,3-dione |
| SMILES | CCN1CCN(CCCCn2c(-c3ccc(O)cc3)c(C)c3cc(O)ccc32)C(=O)C1=O |
| InChI | InChI=1S/C25H29N3O4/c1-3-26-14-15-27(25(32)24(26)31)12-4-5-13-28-22-11-10-20(30)16-21(22)17(2)23(28)18-6-8-19(29)9-7-18/h6-11,16,29-30H,3-5,12-15H2,1-2H3 |
| InChIKey | CKLWXJXUCLBMKV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|