C31H36N4O4 — CID 44581637
4-[(2-acetamidoethylamino)methyl]-N-[4-[5-hydroxy-2-(4-hydroxyphenyl)-3-methylindol-1-yl]butyl]benzamide (PubChem CID 44581637) has the molecular formula C31H36N4O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is 4-[(2-acetamidoethylamino)methyl]-N-[4-[5-hydroxy-2-(4-hydroxyphenyl)-3-methylindol-1-yl]butyl]benzamide.
| Compound Name | 4-[(2-acetamidoethylamino)methyl]-N-[4-[5-hydroxy-2-(4-hydroxyphenyl)-3-methylindol-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 44581637 |
| Molecular Formula | C31H36N4O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 4-[(2-acetamidoethylamino)methyl]-N-[4-[5-hydroxy-2-(4-hydroxyphenyl)-3-methylindol-1-yl]butyl]benzamide |
| SMILES | CC(=O)NCCNCc1ccc(C(=O)NCCCCn2c(-c3ccc(O)cc3)c(C)c3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C31H36N4O4/c1-21-28-19-27(38)13-14-29(28)35(30(21)24-9-11-26(37)12-10-24)18-4-3-15-34-31(39)25-7-5-23(6-8-25)20-32-16-17-33-22(2)36/h5-14,19,32,37-38H,3-4,15-18,20H2,1-2H3,(H,33,36)(H,34,39) |
| InChIKey | KLCNVHZSLYFXDI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|