C28H30N2O3 — CID 23041892
2,3-dihydroisoindol-1-one;2-(4-hydroxyphenyl)-3-methyl-1-pentylindol-5-ol (PubChem CID 23041892) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2,3-dihydroisoindol-1-one;2-(4-hydroxyphenyl)-3-methyl-1-pentylindol-5-ol.
| Compound Name | 2,3-dihydroisoindol-1-one;2-(4-hydroxyphenyl)-3-methyl-1-pentylindol-5-ol |
|---|---|
| PubChem CID | 23041892 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 2,3-dihydroisoindol-1-one;2-(4-hydroxyphenyl)-3-methyl-1-pentylindol-5-ol |
| SMILES | CCCCCn1c(-c2ccc(O)cc2)c(C)c2cc(O)ccc21.O=C1NCc2ccccc21 |
| InChI | InChI=1S/C20H23NO2.C8H7NO/c1-3-4-5-12-21-19-11-10-17(23)13-18(19)14(2)20(21)15-6-8-16(22)9-7-15;10-8-7-4-2-1-3-6(7)5-9-8/h6-11,13,22-23H,3-5,12H2,1-2H3;1-4H,5H2,(H,9,10) |
| InChIKey | HRBRJXNHAYELAF-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|