C25H33N3O2 — CID 141453727
1-[4-(4-ethylpiperazin-1-yl)butyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol (PubChem CID 141453727) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-[4-(4-ethylpiperazin-1-yl)butyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol.
| Compound Name | 1-[4-(4-ethylpiperazin-1-yl)butyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol |
|---|---|
| PubChem CID | 141453727 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 1-[4-(4-ethylpiperazin-1-yl)butyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol |
| SMILES | CCN1CCN(CCCCn2c(-c3ccc(O)cc3)c(C)c3cc(O)ccc32)CC1 |
| InChI | InChI=1S/C25H33N3O2/c1-3-26-14-16-27(17-15-26)12-4-5-13-28-24-11-10-22(30)18-23(24)19(2)25(28)20-6-8-21(29)9-7-20/h6-11,18,29-30H,3-5,12-17H2,1-2H3 |
| InChIKey | ZANPCTZJGQEJBK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|