C30H34N2O2S — CID 22079876
6-[5-hydroxy-3-methyl-2-(4-methylsulfanylphenyl)indol-1-yl]-N-(1-phenylethyl)hexanamide (PubChem CID 22079876) has the molecular formula C30H34N2O2S and a molecular weight of 486.68 g/mol. Its IUPAC name is 6-[5-hydroxy-3-methyl-2-(4-methylsulfanylphenyl)indol-1-yl]-N-(1-phenylethyl)hexanamide.
| Compound Name | 6-[5-hydroxy-3-methyl-2-(4-methylsulfanylphenyl)indol-1-yl]-N-(1-phenylethyl)hexanamide |
|---|---|
| PubChem CID | 22079876 |
| Molecular Formula | C30H34N2O2S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 6-[5-hydroxy-3-methyl-2-(4-methylsulfanylphenyl)indol-1-yl]-N-(1-phenylethyl)hexanamide |
| SMILES | CSc1ccc(-c2c(C)c3cc(O)ccc3n2CCCCCC(=O)NC(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H34N2O2S/c1-21-27-20-25(33)15-18-28(27)32(30(21)24-13-16-26(35-3)17-14-24)19-9-5-8-12-29(34)31-22(2)23-10-6-4-7-11-23/h4,6-7,10-11,13-18,20,22,33H,5,8-9,12,19H2,1-3H3,(H,31,34) |
| InChIKey | ZPIJDJWWDLLZSC-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|