C19H25N3O2S — CID 42739353
5-(1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-(1-phenylethyl)pentanamide (PubChem CID 42739353) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is 5-(1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-(1-phenylethyl)pentanamide.
| Compound Name | 5-(1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-(1-phenylethyl)pentanamide |
|---|---|
| PubChem CID | 42739353 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 5-(1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-(1-phenylethyl)pentanamide |
| SMILES | Cc1cc(=O)n(C)c(SCCCCC(=O)NC(C)c2ccccc2)n1 |
| InChI | InChI=1S/C19H25N3O2S/c1-14-13-18(24)22(3)19(20-14)25-12-8-7-11-17(23)21-15(2)16-9-5-4-6-10-16/h4-6,9-10,13,15H,7-8,11-12H2,1-3H3,(H,21,23) |
| InChIKey | POHMYNUSHRKENZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|