C25H29N3O2S — CID 42739377
N-benzyl-4-(1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-(2-phenylethyl)butanamide (PubChem CID 42739377) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is N-benzyl-4-(1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-(2-phenylethyl)butanamide.
| Compound Name | N-benzyl-4-(1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-(2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 42739377 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-benzyl-4-(1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-(2-phenylethyl)butanamide |
| SMILES | Cc1cc(=O)n(C)c(SCCCC(=O)N(CCc2ccccc2)Cc2ccccc2)n1 |
| InChI | InChI=1S/C25H29N3O2S/c1-20-18-24(30)27(2)25(26-20)31-17-9-14-23(29)28(19-22-12-7-4-8-13-22)16-15-21-10-5-3-6-11-21/h3-8,10-13,18H,9,14-17,19H2,1-2H3 |
| InChIKey | FJYQBTYTFAYBNX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|