C17H26N4O4S — CID 42739384
ethyl 4-[4-(1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanylbutanoyl]piperazine-1-carboxylate (PubChem CID 42739384) has the molecular formula C17H26N4O4S and a molecular weight of 382.49 g/mol. Its IUPAC name is ethyl 4-[4-(1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanylbutanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-(1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanylbutanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 42739384 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | ethyl 4-[4-(1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanylbutanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CCCSc2nc(C)cc(=O)n2C)CC1 |
| InChI | InChI=1S/C17H26N4O4S/c1-4-25-17(24)21-9-7-20(8-10-21)14(22)6-5-11-26-16-18-13(2)12-15(23)19(16)3/h12H,4-11H2,1-3H3 |
| InChIKey | FJFLQSVVZCNGIM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|