C27H38N2O2 — CID 148735806
3-(4-oxopentyl)-1-[1-(4-propan-2-ylidenecyclohexyl)piperidin-4-yl]-3H-indol-2-one (PubChem CID 148735806) has the molecular formula C27H38N2O2 and a molecular weight of 422.61 g/mol. Its IUPAC name is 3-(4-oxopentyl)-1-[1-(4-propan-2-ylidenecyclohexyl)piperidin-4-yl]-3H-indol-2-one.
| Compound Name | 3-(4-oxopentyl)-1-[1-(4-propan-2-ylidenecyclohexyl)piperidin-4-yl]-3H-indol-2-one |
|---|---|
| PubChem CID | 148735806 |
| Molecular Formula | C27H38N2O2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 3-(4-oxopentyl)-1-[1-(4-propan-2-ylidenecyclohexyl)piperidin-4-yl]-3H-indol-2-one |
| SMILES | CC(=O)CCCC1C(=O)N(C2CCN(C3CCC(=C(C)C)CC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C27H38N2O2/c1-19(2)21-11-13-22(14-12-21)28-17-15-23(16-18-28)29-26-10-5-4-8-24(26)25(27(29)31)9-6-7-20(3)30/h4-5,8,10,22-23,25H,6-7,9,11-18H2,1-3H3 |
| InChIKey | OBWGZVRGEFJWKG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|