C13H16FNO2 — CID 1487378
(E,4S)-1-(dimethylamino)-4-(2-fluorophenoxy)pent-1-en-3-one (PubChem CID 1487378) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is (E,4S)-1-(dimethylamino)-4-(2-fluorophenoxy)pent-1-en-3-one.
| Compound Name | (E,4S)-1-(dimethylamino)-4-(2-fluorophenoxy)pent-1-en-3-one |
|---|---|
| PubChem CID | 1487378 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (E,4S)-1-(dimethylamino)-4-(2-fluorophenoxy)pent-1-en-3-one |
| SMILES | C[C@H](Oc1ccccc1F)C(=O)/C=C/N(C)C |
| InChI | InChI=1S/C13H16FNO2/c1-10(12(16)8-9-15(2)3)17-13-7-5-4-6-11(13)14/h4-10H,1-3H3/b9-8+/t10-/m0/s1 |
| InChIKey | HYCKICMHCPYMRZ-DDXVTDLHSA-N |
| XLogP | 2.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|