C29H29N3O3 — CID 148755980
1-[5-[(2-hydroxyethylamino)methyl]-4-(pyridin-2-ylmethoxy)-2-pyridinyl]-2-(2-methyl-3-phenylphenyl)ethanone (PubChem CID 148755980) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-[5-[(2-hydroxyethylamino)methyl]-4-(pyridin-2-ylmethoxy)-2-pyridinyl]-2-(2-methyl-3-phenylphenyl)ethanone.
| Compound Name | 1-[5-[(2-hydroxyethylamino)methyl]-4-(pyridin-2-ylmethoxy)-2-pyridinyl]-2-(2-methyl-3-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 148755980 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1-[5-[(2-hydroxyethylamino)methyl]-4-(pyridin-2-ylmethoxy)-2-pyridinyl]-2-(2-methyl-3-phenylphenyl)ethanone |
| SMILES | Cc1c(CC(=O)c2cc(OCc3ccccn3)c(CNCCO)cn2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C29H29N3O3/c1-21-23(10-7-12-26(21)22-8-3-2-4-9-22)16-28(34)27-17-29(24(19-32-27)18-30-14-15-33)35-20-25-11-5-6-13-31-25/h2-13,17,19,30,33H,14-16,18,20H2,1H3 |
| InChIKey | OFPOUMWULVSAPS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|