C13H22N4O3 — CID 14877966
tert-butyl 2-carbamoyl-4-(2-cyanoethyl)piperazine-1-carboxylate (PubChem CID 14877966) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl 2-carbamoyl-4-(2-cyanoethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-carbamoyl-4-(2-cyanoethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 14877966 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | tert-butyl 2-carbamoyl-4-(2-cyanoethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCC#N)CC1C(N)=O |
| InChI | InChI=1S/C13H22N4O3/c1-13(2,3)20-12(19)17-8-7-16(6-4-5-14)9-10(17)11(15)18/h10H,4,6-9H2,1-3H3,(H2,15,18) |
| InChIKey | ZZRYYVYLIYHVHL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |