C21H27FN2O4 — CID 123621777
1-O-tert-butyl 2-O-methyl 4-[4-(4-fluorophenyl)but-3-ynyl]piperazine-1,2-dicarboxylate (PubChem CID 123621777) has the molecular formula C21H27FN2O4 and a molecular weight of 390.46 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl 4-[4-(4-fluorophenyl)but-3-ynyl]piperazine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl 4-[4-(4-fluorophenyl)but-3-ynyl]piperazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 123621777 |
| Molecular Formula | C21H27FN2O4 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl 4-[4-(4-fluorophenyl)but-3-ynyl]piperazine-1,2-dicarboxylate |
| SMILES | COC(=O)C1CN(CCC#Cc2ccc(F)cc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H27FN2O4/c1-21(2,3)28-20(26)24-14-13-23(15-18(24)19(25)27-4)12-6-5-7-16-8-10-17(22)11-9-16/h8-11,18H,6,12-15H2,1-4H3 |
| InChIKey | NZTIHPUPDAQGAD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|