C25H37N3O6 — CID 70866197
1-O-benzyl 2-O-cyclopentyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]piperazine-1,2-dicarboxylate (PubChem CID 70866197) has the molecular formula C25H37N3O6 and a molecular weight of 475.59 g/mol. Its IUPAC name is 1-O-benzyl 2-O-cyclopentyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]piperazine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-cyclopentyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]piperazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 70866197 |
| Molecular Formula | C25H37N3O6 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 1-O-benzyl 2-O-cyclopentyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]piperazine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)NCCN1CCN(C(=O)OCc2ccccc2)C(C(=O)OC2CCCC2)C1 |
| InChI | InChI=1S/C25H37N3O6/c1-25(2,3)34-23(30)26-13-14-27-15-16-28(24(31)32-18-19-9-5-4-6-10-19)21(17-27)22(29)33-20-11-7-8-12-20/h4-6,9-10,20-21H,7-8,11-18H2,1-3H3,(H,26,30) |
| InChIKey | XGTDIKUTFMISQE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|