C33H41N3O8 — CID 166459287
1-O-tert-butyl 2-O-methyl (2R)-4-[(4S)-4-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-5-oxo-5-phenylmethoxypentyl]piperazine-1,2-dicarboxylate (PubChem CID 166459287) has the molecular formula C33H41N3O8 and a molecular weight of 607.70 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2R)-4-[(4S)-4-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-5-oxo-5-phenylmethoxypentyl]piperazine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2R)-4-[(4S)-4-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-5-oxo-5-phenylmethoxypentyl]piperazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 166459287 |
| Molecular Formula | C33H41N3O8 |
| Molecular Weight | 607.70 g/mol |
| Exact Mass | 607.29 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2R)-4-[(4S)-4-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-5-oxo-5-phenylmethoxypentyl]piperazine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1CN(CCC(C)(C)[C@@H](C(=O)OCc2ccccc2)N2C(=O)c3ccccc3C2=O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H41N3O8/c1-32(2,3)44-31(41)35-19-18-34(20-25(35)29(39)42-6)17-16-33(4,5)26(30(40)43-21-22-12-8-7-9-13-22)36-27(37)23-14-10-11-15-24(23)28(36)38/h7-15,25-26H,16-21H2,1-6H3/t25-,26-/m1/s1 |
| InChIKey | OJYJABVGIJKAJG-CLJLJLNGSA-N |
| XLogP | 3.91 |
| TPSA | 122.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.70 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|