C47H29N5S — CID 148780354
6-[2-benzo[h]quinolin-5-yl-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenyl-1,3-benzothiazole (PubChem CID 148780354) has the molecular formula C47H29N5S and a molecular weight of 695.85 g/mol. Its IUPAC name is 6-[2-benzo[h]quinolin-5-yl-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenyl-1,3-benzothiazole.
| Compound Name | 6-[2-benzo[h]quinolin-5-yl-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 148780354 |
| Molecular Formula | C47H29N5S |
| Molecular Weight | 695.85 g/mol |
| Exact Mass | 695.21 |
| IUPAC Name | 6-[2-benzo[h]quinolin-5-yl-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenyl-1,3-benzothiazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc5nc(-c6ccccc6)sc5c4)c(-c4cc5ccccc5c5ncccc45)c3)n2)cc1 |
| InChI | InChI=1S/C47H29N5S/c1-4-13-30(14-5-1)44-50-45(31-15-6-2-7-16-31)52-46(51-44)35-22-24-36(34-23-25-41-42(29-34)53-47(49-41)32-17-8-3-9-18-32)39(28-35)40-27-33-19-10-11-20-37(33)43-38(40)21-12-26-48-43/h1-29H |
| InChIKey | OKECASCTXWNLBE-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.85 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|