About 3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline
3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline (PubChem CID 14878257) has the molecular formula C10H11ClFN3
and a molecular weight of 227.67 g/mol. Its IUPAC name is 3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline.
Molecular Properties
| Compound Name | 3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline |
| PubChem CID | 14878257 |
| Molecular Formula | C10H11ClFN3 |
| Molecular Weight | 227.67 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline |
| SMILES | Fc1c(Cl)cccc1NCC1=NCCN1 |
| InChI | InChI=1S/C10H11ClFN3/c11-7-2-1-3-8(10(7)12)15-6-9-13-4-5-14-9/h1-3,15H,4-6H2,(H,13,14) |
| InChIKey | FHHRAOHZASBSCZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.67 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline?
The IUPAC name of 3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline (CID 14878257) is 3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline.
What is the SMILES notation for 3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline?
The canonical SMILES for 3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline is Fc1c(Cl)cccc1NCC1=NCCN1.
What is the InChIKey of 3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline?
The InChIKey is FHHRAOHZASBSCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClFN3/c11-7-2-1-3-8(10(7)12)15-6-9-13-4-5-14-9/h1-3,15H,4-6H2,(H,13,14).
What are the key properties of 3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline?
3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline has a molecular weight of 227.67 g/mol, XLogP of 1.89, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-fluoroaniline is sourced from PubChem (CID 14878257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).