C13H17N3 — CID 134156190
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-prop-2-enylaniline (PubChem CID 134156190) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-prop-2-enylaniline.
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-prop-2-enylaniline |
|---|---|
| PubChem CID | 134156190 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-prop-2-enylaniline |
| SMILES | C=CCc1ccccc1NCC1=NCCN1 |
| InChI | InChI=1S/C13H17N3/c1-2-5-11-6-3-4-7-12(11)16-10-13-14-8-9-15-13/h2-4,6-7,16H,1,5,8-10H2,(H,14,15) |
| InChIKey | IYFFDNHPGFKOCO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|