C15H19N3O — CID 22493267
1-[2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]pent-4-en-1-one (PubChem CID 22493267) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-[2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]pent-4-en-1-one.
| Compound Name | 1-[2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]pent-4-en-1-one |
|---|---|
| PubChem CID | 22493267 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 1-[2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)c1ccccc1NCC1=NCCN1 |
| InChI | InChI=1S/C15H19N3O/c1-2-3-8-14(19)12-6-4-5-7-13(12)18-11-15-16-9-10-17-15/h2,4-7,18H,1,3,8-11H2,(H,16,17) |
| InChIKey | IGSDFPKQXAIOHV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|