About 5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine
5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine (PubChem CID 1487974) has the molecular formula C18H17N3O2S
and a molecular weight of 339.42 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine |
| PubChem CID | 1487974 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine |
| SMILES | CN(C)c1nc(-c2ccccc2)ncc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O2S/c1-21(2)18-16(24(22,23)15-11-7-4-8-12-15)13-19-17(20-18)14-9-5-3-6-10-14/h3-13H,1-2H3 |
| InChIKey | DTWXHGYNVUCCSA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine?
The IUPAC name of 5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine (CID 1487974) is 5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine.
What is the SMILES notation for 5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine?
The canonical SMILES for 5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine is CN(C)c1nc(-c2ccccc2)ncc1S(=O)(=O)c1ccccc1.
What is the InChIKey of 5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine?
The InChIKey is DTWXHGYNVUCCSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2S/c1-21(2)18-16(24(22,23)15-11-7-4-8-12-15)13-19-17(20-18)14-9-5-3-6-10-14/h3-13H,1-2H3.
What are the key properties of 5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine?
5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine has a molecular weight of 339.42 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzenesulfonyl)-N,N-dimethyl-2-phenylpyrimidin-4-amine is sourced from PubChem (CID 1487974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).