About 5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine
5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine (PubChem CID 1488188) has the molecular formula C12H14N4O2S
and a molecular weight of 278.34 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine |
| PubChem CID | 1488188 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine |
| SMILES | CN(C)c1ncc(S(=O)(=O)c2ccccc2)c(N)n1 |
| InChI | InChI=1S/C12H14N4O2S/c1-16(2)12-14-8-10(11(13)15-12)19(17,18)9-6-4-3-5-7-9/h3-8H,1-2H3,(H2,13,14,15) |
| InChIKey | OIKGPASQDTZGOZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine?
The IUPAC name of 5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine (CID 1488188) is 5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine.
What is the SMILES notation for 5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine?
The canonical SMILES for 5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine is CN(C)c1ncc(S(=O)(=O)c2ccccc2)c(N)n1.
What is the InChIKey of 5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine?
The InChIKey is OIKGPASQDTZGOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2S/c1-16(2)12-14-8-10(11(13)15-12)19(17,18)9-6-4-3-5-7-9/h3-8H,1-2H3,(H2,13,14,15).
What are the key properties of 5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine?
5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine has a molecular weight of 278.34 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzenesulfonyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine is sourced from PubChem (CID 1488188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).