C10H9ClN4O2S — CID 2819040
5-(4-chlorophenyl)sulfonylpyrimidine-2,4-diamine (PubChem CID 2819040) has the molecular formula C10H9ClN4O2S and a molecular weight of 284.73 g/mol. Its IUPAC name is 5-(4-chlorophenyl)sulfonylpyrimidine-2,4-diamine.
| Compound Name | 5-(4-chlorophenyl)sulfonylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 2819040 |
| Molecular Formula | C10H9ClN4O2S |
| Molecular Weight | 284.73 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 5-(4-chlorophenyl)sulfonylpyrimidine-2,4-diamine |
| SMILES | Nc1ncc(S(=O)(=O)c2ccc(Cl)cc2)c(N)n1 |
| InChI | InChI=1S/C10H9ClN4O2S/c11-6-1-3-7(4-2-6)18(16,17)8-5-14-10(13)15-9(8)12/h1-5H,(H4,12,13,14,15) |
| InChIKey | RPPFHWBHHCJZJS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.73 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |