C15H16ClN3O2S2 — CID 2819306
4-[5-(4-chlorophenyl)sulfonyl-4-methylpyrimidin-2-yl]thiomorpholine (PubChem CID 2819306) has the molecular formula C15H16ClN3O2S2 and a molecular weight of 369.90 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)sulfonyl-4-methylpyrimidin-2-yl]thiomorpholine.
| Compound Name | 4-[5-(4-chlorophenyl)sulfonyl-4-methylpyrimidin-2-yl]thiomorpholine |
|---|---|
| PubChem CID | 2819306 |
| Molecular Formula | C15H16ClN3O2S2 |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 4-[5-(4-chlorophenyl)sulfonyl-4-methylpyrimidin-2-yl]thiomorpholine |
| SMILES | Cc1nc(N2CCSCC2)ncc1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClN3O2S2/c1-11-14(23(20,21)13-4-2-12(16)3-5-13)10-17-15(18-11)19-6-8-22-9-7-19/h2-5,10H,6-9H2,1H3 |
| InChIKey | ZRJNWYJOCDRXPQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |