C11H18O3 — CID 148805131
8-hydroxy-3,3-dimethyl-1-oxaspiro[4.5]decan-2-one (PubChem CID 148805131) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 8-hydroxy-3,3-dimethyl-1-oxaspiro[4.5]decan-2-one.
| Compound Name | 8-hydroxy-3,3-dimethyl-1-oxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 148805131 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 8-hydroxy-3,3-dimethyl-1-oxaspiro[4.5]decan-2-one |
| SMILES | CC1(C)CC2(CCC(O)CC2)OC1=O |
| InChI | InChI=1S/C11H18O3/c1-10(2)7-11(14-9(10)13)5-3-8(12)4-6-11/h8,12H,3-7H2,1-2H3 |
| InChIKey | OOUNYGAOMHZIIU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |