C21H28O4 — CID 15558373
7-hydroxy-10,17-dimethyl-16,21-dioxahexacyclo[15.3.1.01,14.02,11.05,10.014,18]henicos-4-en-15-one (PubChem CID 15558373) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 7-hydroxy-10,17-dimethyl-16,21-dioxahexacyclo[15.3.1.01,14.02,11.05,10.014,18]henicos-4-en-15-one.
| Compound Name | 7-hydroxy-10,17-dimethyl-16,21-dioxahexacyclo[15.3.1.01,14.02,11.05,10.014,18]henicos-4-en-15-one |
|---|---|
| PubChem CID | 15558373 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 7-hydroxy-10,17-dimethyl-16,21-dioxahexacyclo[15.3.1.01,14.02,11.05,10.014,18]henicos-4-en-15-one |
| SMILES | CC12OC(=O)C34CCC5C(CC=C6CC(O)CCC65C)C3(CCC14)O2 |
| InChI | InChI=1S/C21H28O4/c1-18-8-5-13(22)11-12(18)3-4-15-14(18)6-9-20-16-7-10-21(15,20)25-19(16,2)24-17(20)23/h3,13-16,22H,4-11H2,1-2H3 |
| InChIKey | NASKFPKLPIQGLM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|