C21H30O4 — CID 132553533
(1S,2R,7S,10R,11S,14R,15R)-10,14,16-trimethyl-17,20,21-trioxahexacyclo[14.4.1.01,14.02,11.05,10.015,19]henicos-4-en-7-ol (PubChem CID 132553533) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (1S,2R,7S,10R,11S,14R,15R)-10,14,16-trimethyl-17,20,21-trioxahexacyclo[14.4.1.01,14.02,11.05,10.015,19]henicos-4-en-7-ol.
| Compound Name | (1S,2R,7S,10R,11S,14R,15R)-10,14,16-trimethyl-17,20,21-trioxahexacyclo[14.4.1.01,14.02,11.05,10.015,19]henicos-4-en-7-ol |
|---|---|
| PubChem CID | 132553533 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (1S,2R,7S,10R,11S,14R,15R)-10,14,16-trimethyl-17,20,21-trioxahexacyclo[14.4.1.01,14.02,11.05,10.015,19]henicos-4-en-7-ol |
| SMILES | CC12OCC3O[C@]4(O1)[C@@H]1CC=C5C[C@@H](O)CC[C@]5(C)[C@H]1CC[C@]4(C)[C@H]32 |
| InChI | InChI=1S/C21H30O4/c1-18-8-6-13(22)10-12(18)4-5-15-14(18)7-9-19(2)17-16-11-23-20(17,3)25-21(15,19)24-16/h4,13-17,22H,5-11H2,1-3H3/t13-,14-,15+,16?,17-,18-,19+,20?,21-/m0/s1 |
| InChIKey | WCHLOFYYBHNRBA-BRKWEKHUSA-N |
| XLogP | 3.39 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|