C21H30O5 — CID 21054047
10,14-dimethyl-17,20,22-trioxahexacyclo[14.5.1.01,14.02,11.05,10.015,19]docos-4-ene-7,21-diol (PubChem CID 21054047) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 10,14-dimethyl-17,20,22-trioxahexacyclo[14.5.1.01,14.02,11.05,10.015,19]docos-4-ene-7,21-diol.
| Compound Name | 10,14-dimethyl-17,20,22-trioxahexacyclo[14.5.1.01,14.02,11.05,10.015,19]docos-4-ene-7,21-diol |
|---|---|
| PubChem CID | 21054047 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 10,14-dimethyl-17,20,22-trioxahexacyclo[14.5.1.01,14.02,11.05,10.015,19]docos-4-ene-7,21-diol |
| SMILES | CC12CCC(O)CC1=CCC1C2CCC2(C)C3C4COC3OC12C(O)O4 |
| InChI | InChI=1S/C21H30O5/c1-19-7-5-12(22)9-11(19)3-4-14-13(19)6-8-20(2)16-15-10-24-17(16)26-21(14,20)18(23)25-15/h3,12-18,22-23H,4-10H2,1-2H3 |
| InChIKey | RDZXKBCQYWCSCU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|