C28H40O9 — CID 73063634
2-[3-methoxy-3-oxo-1-[(10,14,16-trimethyl-17,20,21-trioxahexacyclo[14.4.1.01,14.02,11.05,10.015,19]henicos-4-en-7-yl)oxy]propoxy]propanoic acid (PubChem CID 73063634) has the molecular formula C28H40O9 and a molecular weight of 520.62 g/mol. Its IUPAC name is 2-[3-methoxy-3-oxo-1-[(10,14,16-trimethyl-17,20,21-trioxahexacyclo[14.4.1.01,14.02,11.05,10.015,19]henicos-4-en-7-yl)oxy]propoxy]propanoic acid.
| Compound Name | 2-[3-methoxy-3-oxo-1-[(10,14,16-trimethyl-17,20,21-trioxahexacyclo[14.4.1.01,14.02,11.05,10.015,19]henicos-4-en-7-yl)oxy]propoxy]propanoic acid |
|---|---|
| PubChem CID | 73063634 |
| Molecular Formula | C28H40O9 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 2-[3-methoxy-3-oxo-1-[(10,14,16-trimethyl-17,20,21-trioxahexacyclo[14.4.1.01,14.02,11.05,10.015,19]henicos-4-en-7-yl)oxy]propoxy]propanoic acid |
| SMILES | COC(=O)CC(OC1CCC2(C)C(=CCC3C2CCC2(C)C4C5COC4(C)OC32O5)C1)OC(C)C(=O)O |
| InChI | InChI=1S/C28H40O9/c1-15(24(30)31)34-22(13-21(29)32-5)35-17-8-10-25(2)16(12-17)6-7-19-18(25)9-11-26(3)23-20-14-33-27(23,4)37-28(19,26)36-20/h6,15,17-20,22-23H,7-14H2,1-5H3,(H,30,31) |
| InChIKey | LAGKFZXTTOABAX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|