About 4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran
4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran (PubChem CID 148822153) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran |
| PubChem CID | 148822153 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran |
| SMILES | COCC1=C(OC)CCO1 |
| InChI | InChI=1S/C7H12O3/c1-8-5-7-6(9-2)3-4-10-7/h3-5H2,1-2H3 |
| InChIKey | ORZQZDFOABYORG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran?
The IUPAC name of 4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran (CID 148822153) is 4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran.
What is the SMILES notation for 4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran?
The canonical SMILES for 4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran is COCC1=C(OC)CCO1.
What is the InChIKey of 4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran?
The InChIKey is ORZQZDFOABYORG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-8-5-7-6(9-2)3-4-10-7/h3-5H2,1-2H3.
What are the key properties of 4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran?
4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran has a molecular weight of 144.17 g/mol, XLogP of 0.91, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-5-(methoxymethyl)-2,3-dihydrofuran is sourced from PubChem (CID 148822153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).