C8H14O4 — CID 147013484
3,4-dimethoxy-5-(methoxymethyl)-2,3-dihydrofuran (PubChem CID 147013484) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is 3,4-dimethoxy-5-(methoxymethyl)-2,3-dihydrofuran.
| Compound Name | 3,4-dimethoxy-5-(methoxymethyl)-2,3-dihydrofuran |
|---|---|
| PubChem CID | 147013484 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 3,4-dimethoxy-5-(methoxymethyl)-2,3-dihydrofuran |
| SMILES | COCC1=C(OC)C(OC)CO1 |
| InChI | InChI=1S/C8H14O4/c1-9-4-7-8(11-3)6(10-2)5-12-7/h6H,4-5H2,1-3H3 |
| InChIKey | AUIBUIVVOOFMLT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |