C8H16O3 — CID 123940031
2,3,4-trimethoxypent-2-ene (PubChem CID 123940031) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is 2,3,4-trimethoxypent-2-ene.
| Compound Name | 2,3,4-trimethoxypent-2-ene |
|---|---|
| PubChem CID | 123940031 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 2,3,4-trimethoxypent-2-ene |
| SMILES | COC(C)=C(OC)C(C)OC |
| InChI | InChI=1S/C8H16O3/c1-6(9-3)8(11-5)7(2)10-4/h6H,1-5H3 |
| InChIKey | IDXRPIIFXOVWIQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|