C8H16O2 — CID 91050234
2,4-dimethoxy-3-methylpent-2-ene (PubChem CID 91050234) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is 2,4-dimethoxy-3-methylpent-2-ene.
| Compound Name | 2,4-dimethoxy-3-methylpent-2-ene |
|---|---|
| PubChem CID | 91050234 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 2,4-dimethoxy-3-methylpent-2-ene |
| SMILES | COC(C)=C(C)C(C)OC |
| InChI | InChI=1S/C8H16O2/c1-6(7(2)9-4)8(3)10-5/h7H,1-5H3 |
| InChIKey | UWYXXQCPGKYVCW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|