About (Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron
(Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron (PubChem CID 59078962) has the molecular formula C11H18FFe3O-
and a molecular weight of 352.80 g/mol. Its IUPAC name is (Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron.
Molecular Properties
| Compound Name | (Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron |
| PubChem CID | 59078962 |
| Molecular Formula | C11H18FFe3O- |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | (Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron |
| SMILES | [CH2-]C(OC(C)=C(C)C)/C(C)=C(/C)F.[Fe].[Fe].[Fe] |
| InChI | InChI=1S/C11H18FO.3Fe/c1-7(2)10(5)13-11(6)8(3)9(4)12;;;/h11H,6H2,1-5H3;;;/q-1;;;/b9-8-;;; |
| InChIKey | ZCEKYSIDAPBNFD-DQNNFYOXSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron?
The IUPAC name of (Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron (CID 59078962) is (Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron.
What is the SMILES notation for (Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron?
The canonical SMILES for (Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron is [CH2-]C(OC(C)=C(C)C)/C(C)=C(/C)F.[Fe].[Fe].[Fe].
What is the InChIKey of (Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron?
The InChIKey is ZCEKYSIDAPBNFD-DQNNFYOXSA-N. The full InChI is InChI=1S/C11H18FO.3Fe/c1-7(2)10(5)13-11(6)8(3)9(4)12;;;/h11H,6H2,1-5H3;;;/q-1;;;/b9-8-;;;.
What are the key properties of (Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron?
(Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron has a molecular weight of 352.80 g/mol, XLogP of 3.78, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-fluoro-3-methyl-4-(3-methylbut-2-en-2-yloxy)pent-2-ene;iron is sourced from PubChem (CID 59078962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).