C11H20O3 — CID 123881669
2,4,6-trimethoxy-5-methylhepta-2,4-diene (PubChem CID 123881669) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2,4,6-trimethoxy-5-methylhepta-2,4-diene.
| Compound Name | 2,4,6-trimethoxy-5-methylhepta-2,4-diene |
|---|---|
| PubChem CID | 123881669 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2,4,6-trimethoxy-5-methylhepta-2,4-diene |
| SMILES | COC(C)=CC(OC)=C(C)C(C)OC |
| InChI | InChI=1S/C11H20O3/c1-8(12-4)7-11(14-6)9(2)10(3)13-5/h7,10H,1-6H3 |
| InChIKey | FUFLPAHCTTZTBQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|