C10H19O2Y- — CID 59027665
(Z)-4-methanidyl-3,5-dimethoxyhept-3-ene;yttrium (PubChem CID 59027665) has the molecular formula C10H19O2Y- and a molecular weight of 260.17 g/mol. Its IUPAC name is (Z)-4-methanidyl-3,5-dimethoxyhept-3-ene;yttrium.
| Compound Name | (Z)-4-methanidyl-3,5-dimethoxyhept-3-ene;yttrium |
|---|---|
| PubChem CID | 59027665 |
| Molecular Formula | C10H19O2Y- |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | (Z)-4-methanidyl-3,5-dimethoxyhept-3-ene;yttrium |
| SMILES | [CH2-]/C(=C(\CC)OC)C(CC)OC.[Y] |
| InChI | InChI=1S/C10H19O2.Y/c1-6-9(11-4)8(3)10(7-2)12-5;/h9H,3,6-7H2,1-2,4-5H3;/q-1;/b10-8-; |
| InChIKey | DXZAOKYRVKGGMP-DQMXGCRQSA-N |
| XLogP | 2.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|