C10H20O2 — CID 59027666
(Z)-3,5-dimethoxy-4-methylhept-3-ene (PubChem CID 59027666) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is (Z)-3,5-dimethoxy-4-methylhept-3-ene.
| Compound Name | (Z)-3,5-dimethoxy-4-methylhept-3-ene |
|---|---|
| PubChem CID | 59027666 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (Z)-3,5-dimethoxy-4-methylhept-3-ene |
| SMILES | CC/C(OC)=C(\C)C(CC)OC |
| InChI | InChI=1S/C10H20O2/c1-6-9(11-4)8(3)10(7-2)12-5/h9H,6-7H2,1-5H3/b10-8- |
| InChIKey | BKUCJTZEXBRMET-NTMALXAHSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|