C15H26O — CID 10537024
(2E)-3,7-dimethyl-1-[(E)-2-methylbut-1-enoxy]octa-2,6-diene (PubChem CID 10537024) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-1-[(E)-2-methylbut-1-enoxy]octa-2,6-diene.
| Compound Name | (2E)-3,7-dimethyl-1-[(E)-2-methylbut-1-enoxy]octa-2,6-diene |
|---|---|
| PubChem CID | 10537024 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (2E)-3,7-dimethyl-1-[(E)-2-methylbut-1-enoxy]octa-2,6-diene |
| SMILES | CC/C(C)=C/OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H26O/c1-6-14(4)12-16-11-10-15(5)9-7-8-13(2)3/h8,10,12H,6-7,9,11H2,1-5H3/b14-12+,15-10+ |
| InChIKey | YQJBJPDAXFWAIO-KPWNYXQSSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|