C10H20O — CID 59039384
(4R)-4-methoxy-2,3,5-trimethylhex-2-ene (PubChem CID 59039384) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is (4R)-4-methoxy-2,3,5-trimethylhex-2-ene.
| Compound Name | (4R)-4-methoxy-2,3,5-trimethylhex-2-ene |
|---|---|
| PubChem CID | 59039384 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (4R)-4-methoxy-2,3,5-trimethylhex-2-ene |
| SMILES | CO[C@@H](C(C)=C(C)C)C(C)C |
| InChI | InChI=1S/C10H20O/c1-7(2)9(5)10(11-6)8(3)4/h8,10H,1-6H3/t10-/m1/s1 |
| InChIKey | CWPAGSNJXUZJSX-SNVBAGLBSA-N |
| XLogP | 3.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|