C9H18O — CID 23385077
(E)-4-methoxy-3,5-dimethylhex-2-ene (PubChem CID 23385077) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is (E)-4-methoxy-3,5-dimethylhex-2-ene.
| Compound Name | (E)-4-methoxy-3,5-dimethylhex-2-ene |
|---|---|
| PubChem CID | 23385077 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (E)-4-methoxy-3,5-dimethylhex-2-ene |
| SMILES | C/C=C(\C)C(OC)C(C)C |
| InChI | InChI=1S/C9H18O/c1-6-8(4)9(10-5)7(2)3/h6-7,9H,1-5H3/b8-6+ |
| InChIKey | LNWHNVHSAHNXOI-SOFGYWHQSA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|