C9H18O2 — CID 91148659
2,4-dimethoxy-3-methylhex-2-ene (PubChem CID 91148659) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is 2,4-dimethoxy-3-methylhex-2-ene.
| Compound Name | 2,4-dimethoxy-3-methylhex-2-ene |
|---|---|
| PubChem CID | 91148659 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 2,4-dimethoxy-3-methylhex-2-ene |
| SMILES | CCC(OC)C(C)=C(C)OC |
| InChI | InChI=1S/C9H18O2/c1-6-9(11-5)7(2)8(3)10-4/h9H,6H2,1-5H3 |
| InChIKey | SBTXSBMTLAEFBO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|