About (E)-3,4-dimethoxypent-2-ene
(E)-3,4-dimethoxypent-2-ene (PubChem CID 143241660) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is (E)-3,4-dimethoxypent-2-ene.
Molecular Properties
| Compound Name | (E)-3,4-dimethoxypent-2-ene |
| PubChem CID | 143241660 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (E)-3,4-dimethoxypent-2-ene |
| SMILES | C/C=C(/OC)C(C)OC |
| InChI | InChI=1S/C7H14O2/c1-5-7(9-4)6(2)8-3/h5-6H,1-4H3/b7-5+ |
| InChIKey | PSOKJHYCFNZLBT-FNORWQNLSA-N |
| XLogP | 1.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (E)-3,4-dimethoxypent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3,4-dimethoxypent-2-ene?
The IUPAC name of (E)-3,4-dimethoxypent-2-ene (CID 143241660) is (E)-3,4-dimethoxypent-2-ene.
What is the SMILES notation for (E)-3,4-dimethoxypent-2-ene?
The canonical SMILES for (E)-3,4-dimethoxypent-2-ene is C/C=C(/OC)C(C)OC.
What is the InChIKey of (E)-3,4-dimethoxypent-2-ene?
The InChIKey is PSOKJHYCFNZLBT-FNORWQNLSA-N. The full InChI is InChI=1S/C7H14O2/c1-5-7(9-4)6(2)8-3/h5-6H,1-4H3/b7-5+.
What are the key properties of (E)-3,4-dimethoxypent-2-ene?
(E)-3,4-dimethoxypent-2-ene has a molecular weight of 130.19 g/mol, XLogP of 1.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,4-dimethoxypent-2-ene is sourced from PubChem (CID 143241660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).