About (E,4S)-4-ethenoxypent-2-ene
(E,4S)-4-ethenoxypent-2-ene (PubChem CID 134839398) has the molecular formula C7H12O
and a molecular weight of 112.17 g/mol. Its IUPAC name is (E,4S)-4-ethenoxypent-2-ene.
Molecular Properties
| Compound Name | (E,4S)-4-ethenoxypent-2-ene |
| PubChem CID | 134839398 |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | (E,4S)-4-ethenoxypent-2-ene |
| SMILES | C=CO[C@@H](C)/C=C/C |
| InChI | InChI=1S/C7H12O/c1-4-6-7(3)8-5-2/h4-7H,2H2,1,3H3/b6-4+/t7-/m0/s1 |
| InChIKey | PJJJSPBDXSGONK-KNIZRNDPSA-N |
| XLogP | 2.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E,4S)-4-ethenoxypent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,4S)-4-ethenoxypent-2-ene?
The IUPAC name of (E,4S)-4-ethenoxypent-2-ene (CID 134839398) is (E,4S)-4-ethenoxypent-2-ene.
What is the SMILES notation for (E,4S)-4-ethenoxypent-2-ene?
The canonical SMILES for (E,4S)-4-ethenoxypent-2-ene is C=CO[C@@H](C)/C=C/C.
What is the InChIKey of (E,4S)-4-ethenoxypent-2-ene?
The InChIKey is PJJJSPBDXSGONK-KNIZRNDPSA-N. The full InChI is InChI=1S/C7H12O/c1-4-6-7(3)8-5-2/h4-7H,2H2,1,3H3/b6-4+/t7-/m0/s1.
What are the key properties of (E,4S)-4-ethenoxypent-2-ene?
(E,4S)-4-ethenoxypent-2-ene has a molecular weight of 112.17 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,4S)-4-ethenoxypent-2-ene is sourced from PubChem (CID 134839398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).