C6H10O — CID 557796
2,5-dimethyl-2,5-dihydrofuran (PubChem CID 557796) has the molecular formula C6H10O and a molecular weight of 98.14 g/mol. Its IUPAC name is 2,5-dimethyl-2,5-dihydrofuran.
| Compound Name | 2,5-dimethyl-2,5-dihydrofuran |
|---|---|
| PubChem CID | 557796 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | 2,5-dimethyl-2,5-dihydrofuran |
| SMILES | CC1C=CC(C)O1 |
| InChI | InChI=1S/C6H10O/c1-5-3-4-6(2)7-5/h3-6H,1-2H3 |
| InChIKey | UZYVJMDRMHWAPX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|