C38H40N4O6S — CID 14882549
4-[[3,6-bis[(E)-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]indol-1-yl]methyl]-3-methoxy-N-(2-methylphenyl)sulfonylbenzamide (PubChem CID 14882549) has the molecular formula C38H40N4O6S and a molecular weight of 680.83 g/mol. Its IUPAC name is 4-[[3,6-bis[(E)-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]indol-1-yl]methyl]-3-methoxy-N-(2-methylphenyl)sulfonylbenzamide.
| Compound Name | 4-[[3,6-bis[(E)-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]indol-1-yl]methyl]-3-methoxy-N-(2-methylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 14882549 |
| Molecular Formula | C38H40N4O6S |
| Molecular Weight | 680.83 g/mol |
| Exact Mass | 680.27 |
| IUPAC Name | 4-[[3,6-bis[(E)-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]indol-1-yl]methyl]-3-methoxy-N-(2-methylphenyl)sulfonylbenzamide |
| SMILES | COc1cc(C(=O)NS(=O)(=O)c2ccccc2C)ccc1Cn1cc(/C=C/C(=O)N2CCCC2)c2ccc(/C=C/C(=O)N3CCCC3)cc21 |
| InChI | InChI=1S/C38H40N4O6S/c1-27-9-3-4-10-35(27)49(46,47)39-38(45)29-13-14-31(34(24-29)48-2)26-42-25-30(15-18-37(44)41-21-7-8-22-41)32-16-11-28(23-33(32)42)12-17-36(43)40-19-5-6-20-40/h3-4,9-18,23-25H,5-8,19-22,26H2,1-2H3,(H,39,45)/b17-12+,18-15+ |
| InChIKey | XQAMHEKNRAEQIS-NLKSIUOISA-N |
| XLogP | 5.40 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.83 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|