C32H35N3O5 — CID 14882547
methyl 4-[[3,6-bis[(E)-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]indol-1-yl]methyl]-3-methoxybenzoate (PubChem CID 14882547) has the molecular formula C32H35N3O5 and a molecular weight of 541.65 g/mol. Its IUPAC name is methyl 4-[[3,6-bis[(E)-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]indol-1-yl]methyl]-3-methoxybenzoate.
| Compound Name | methyl 4-[[3,6-bis[(E)-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]indol-1-yl]methyl]-3-methoxybenzoate |
|---|---|
| PubChem CID | 14882547 |
| Molecular Formula | C32H35N3O5 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | methyl 4-[[3,6-bis[(E)-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]indol-1-yl]methyl]-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(Cn2cc(/C=C/C(=O)N3CCCC3)c3ccc(/C=C/C(=O)N4CCCC4)cc32)c(OC)c1 |
| InChI | InChI=1S/C32H35N3O5/c1-39-29-20-24(32(38)40-2)9-10-26(29)22-35-21-25(11-14-31(37)34-17-5-6-18-34)27-12-7-23(19-28(27)35)8-13-30(36)33-15-3-4-16-33/h7-14,19-21H,3-6,15-18,22H2,1-2H3/b13-8+,14-11+ |
| InChIKey | QZPHPDBXPIWKIW-HVUCGZAQSA-N |
| XLogP | 4.76 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|