C35H50N4O6 — CID 148837087
2,2-dimethylpropyl N-[(1S)-1-(2,3-dihydro-1H-inden-2-yl)-2-[(2S,3R)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]carbamoyl]-3-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 148837087) has the molecular formula C35H50N4O6 and a molecular weight of 622.81 g/mol. Its IUPAC name is 2,2-dimethylpropyl N-[(1S)-1-(2,3-dihydro-1H-inden-2-yl)-2-[(2S,3R)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]carbamoyl]-3-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | 2,2-dimethylpropyl N-[(1S)-1-(2,3-dihydro-1H-inden-2-yl)-2-[(2S,3R)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]carbamoyl]-3-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 148837087 |
| Molecular Formula | C35H50N4O6 |
| Molecular Weight | 622.81 g/mol |
| Exact Mass | 622.37 |
| IUPAC Name | 2,2-dimethylpropyl N-[(1S)-1-(2,3-dihydro-1H-inden-2-yl)-2-[(2S,3R)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]carbamoyl]-3-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | C=CCCC(NC(=O)[C@@H]1[C@@H](C(C)C)CCN1C(=O)[C@@H](NC(=O)OCC(C)(C)C)C1Cc2ccccc2C1)C(=O)C(=O)NCC=C |
| InChI | InChI=1S/C35H50N4O6/c1-8-10-15-27(30(40)32(42)36-17-9-2)37-31(41)29-26(22(3)4)16-18-39(29)33(43)28(38-34(44)45-21-35(5,6)7)25-19-23-13-11-12-14-24(23)20-25/h8-9,11-14,22,25-29H,1-2,10,15-21H2,3-7H3,(H,36,42)(H,37,41)(H,38,44)/t26-,27?,28+,29+/m1/s1 |
| InChIKey | OUUMTVFBPASXLF-POQGNYHUSA-N |
| XLogP | 3.74 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.81 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|